CAS 1353959-33-7

1-(Phenylmethyl) 2-[[(carboxymethyl)thio]methyl]-1-pyrrolidinecarboxylate

Description:

1-(Phenylmethyl) 2-[[(carboxymethyl)thio]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1353959-33-7, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a phenylmethyl group, a carboxymethylthio substituent, and an ester functional group. The molecular structure suggests potential applications in medicinal chemistry, particularly due to the presence of functional groups that may interact with biological targets. The carboxymethylthio moiety could enhance solubility and reactivity, while the pyrrolidine ring may contribute to conformational flexibility. Additionally, the compound's properties, such as solubility, stability, and reactivity, would be influenced by the specific arrangement of its substituents and the overall electronic environment. As with many organic compounds, the synthesis and characterization of this substance would be essential for understanding its potential applications and biological activity. Further studies would be necessary to explore its pharmacological properties and any potential therapeutic uses.

Formula: C₁₅H₁₉NO₄S

InChI: InChI=1S/C15H19NO4S/c17-14(18)11-21-10-13-7-4-8-16(13)15(19)20-9-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,17,18)

InChI key: InChIKey=MUJQPECFMXFDHZ-UHFFFAOYSA-N

SMILES: C(SCC(O)=O)C1N(C(OCC2=CC=CC=C2)=O)CCC1

Synonyms:

• 1-(Phenylmethyl) 2-[[(carboxymethyl)thio]methyl]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 2-[[(carboxymethyl)thio]methyl]-, 1-(phenylmethyl) ester