CAS 1353959-55-3

Phenylmethyl 4-[[(2-aminoethyl)thio]methyl]-1-piperidinecarboxylate

Description:

Phenylmethyl 4-[[(2-aminoethyl)thio]methyl]-1-piperidinecarboxylate, identified by its CAS number 1353959-55-3, is a chemical compound characterized by its complex structure that includes a piperidine ring, a carboxylate group, and a phenylmethyl moiety. This compound features a thioether linkage due to the presence of a sulfur atom in the side chain, which contributes to its unique reactivity and potential biological activity. The aminoethyl group suggests that it may interact with biological systems, possibly influencing neurotransmitter pathways or exhibiting pharmacological properties. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The presence of both hydrophilic and hydrophobic regions in its structure may affect its solubility and permeability, which are critical factors in drug design. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and pharmaceutical applications.

Formula: C₁₆H₂₄N₂O₂S

InChI: InChI=1S/C16H24N2O2S/c17-8-11-21-13-15-6-9-18(10-7-15)16(19)20-12-14-4-2-1-3-5-14/h1-5,15H,6-13,17H2

InChI key: InChIKey=NPYGFDCRLRGQEP-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2CCC(CSCCN)CC2

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[(2-aminoethyl)thio]methyl]-, phenylmethyl ester
• Phenylmethyl 4-[[(2-aminoethyl)thio]methyl]-1-piperidinecarboxylate