CymitQuimica logo

CAS 1353959-70-2

:

2-Chloro-N-ethyl-N-[(1-methyl-4-piperidinyl)methyl]acetamide

Description:
2-Chloro-N-ethyl-N-[(1-methyl-4-piperidinyl)methyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, an ethyl group, and a piperidine moiety. This compound features a chloro substituent on the second carbon of the acetamide group, contributing to its reactivity and potential biological activity. The presence of the piperidine ring, specifically the 1-methyl-4-piperidinyl group, suggests that it may interact with biological systems, possibly influencing neurotransmitter pathways or exhibiting pharmacological properties. The compound is likely to be a solid or liquid at room temperature, depending on its specific formulation and purity. Its molecular interactions may include hydrogen bonding due to the amide functional group, and it may exhibit moderate solubility in polar solvents. As with many compounds containing halogens and nitrogen, it is essential to handle this substance with care, considering potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications in various fields, including medicinal chemistry and pharmacology.
Formula:C11H21ClN2O
InChI:InChI=1S/C11H21ClN2O/c1-3-14(11(15)8-12)9-10-4-6-13(2)7-5-10/h10H,3-9H2,1-2H3
InChI key:InChIKey=VZUSRLSWOFCXCE-UHFFFAOYSA-N
SMILES:C(N(C(CCl)=O)CC)C1CCN(C)CC1
Synonyms:
  • 2-Chloro-N-ethyl-N-[(1-methyl-4-piperidinyl)methyl]acetamide
  • Acetamide, 2-chloro-N-ethyl-N-[(1-methyl-4-piperidinyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.