CAS 1353960-33-4

1,1-Dimethylethyl 3-[(2-chloroacetyl)ethylamino]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(2-chloroacetyl)ethylamino]-1-pyrrolidinecarboxylate, identified by its CAS number 1353960-33-4, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group, which contributes to its steric bulk, and a chloroacetyl group that introduces reactivity due to the presence of the chlorine atom. The ethylamino substituent enhances its potential for biological activity, making it of interest in medicinal chemistry. The ester functional group in the structure indicates that it can undergo hydrolysis, which may affect its stability and reactivity in various environments. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities and properties would require further investigation through empirical studies.

Formula: C₁₃H₂₃ClN₂O₃

InChI: InChI=1S/C13H23ClN2O3/c1-5-16(11(17)8-14)10-6-7-15(9-10)12(18)19-13(2,3)4/h10H,5-9H2,1-4H3

InChI key: InChIKey=OTZYBKCXUPUDMP-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)(CC)C1CN(C(OC(C)(C)C)=O)CC1