CymitQuimica logo

CAS 1353960-72-1

:

2-Chloro-N-(1-isoquinolinylmethyl)-N-methylacetamide

Description:
2-Chloro-N-(1-isoquinolinylmethyl)-N-methylacetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent, an isoquinoline moiety, and an acetamide functional group. This compound typically exhibits properties associated with both amides and halogenated compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the chlorine atom. The isoquinoline ring contributes to its aromatic character, which may influence its electronic properties and interactions with biological targets. The presence of the methyl and chloro groups can also affect its lipophilicity and overall stability. As a result, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the isoquinoline structure is often associated with various biological activities. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C13H13ClN2O
InChI:InChI=1S/C13H13ClN2O/c1-16(13(17)8-14)9-12-11-5-3-2-4-10(11)6-7-15-12/h2-7H,8-9H2,1H3
InChI key:InChIKey=QBRLXSSIJVTCAR-UHFFFAOYSA-N
SMILES:C(N(C(CCl)=O)C)C=1C2=C(C=CN1)C=CC=C2
Synonyms:
  • 2-Chloro-N-(1-isoquinolinylmethyl)-N-methylacetamide
  • Acetamide, 2-chloro-N-(1-isoquinolinylmethyl)-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.