CAS 1353961-40-6

2-[[1-(Phenylmethyl)-3-piperidinyl]oxy]acetic acid

Description:

2-[[1-(Phenylmethyl)-3-piperidinyl]oxy]acetic acid, identified by its CAS number 1353961-40-6, is a chemical compound characterized by its unique structure that includes a piperidine ring and a phenylmethyl group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the nitrogen atom in the piperidine ring. It is likely to be soluble in polar solvents, given the presence of the hydroxyl and carboxylic acid groups, while its aromatic component may contribute to hydrophobic interactions. The compound may also exhibit biological activity, potentially interacting with various receptors or enzymes due to its structural features. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry for its potential therapeutic applications. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1S/C14H19NO3/c16-14(17)11-18-13-7-4-8-15(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,16,17)

InChI key: InChIKey=SELQQDOFIWDOSV-UHFFFAOYSA-N

SMILES: C(N1CC(OCC(O)=O)CCC1)C2=CC=CC=C2

Synonyms:

• Acetic acid, 2-[[1-(phenylmethyl)-3-piperidinyl]oxy]-
• 2-[[1-(Phenylmethyl)-3-piperidinyl]oxy]acetic acid