CymitQuimica logo

CAS 1353961-64-4

:

N-Cyclopropyl-N-(1-methyl-4-piperidinyl)glycine

Description:
N-Cyclopropyl-N-(1-methyl-4-piperidinyl)glycine, identified by its CAS number 1353961-64-4, is a chemical compound that belongs to the class of amino acids and derivatives. It features a cyclopropyl group and a piperidine moiety, which contribute to its unique structural and functional properties. This compound is often studied for its potential pharmacological applications, particularly in the field of neuroscience, where it may act as a modulator of neurotransmitter systems. The presence of the piperidine ring suggests that it may interact with various receptors in the central nervous system, potentially influencing cognitive and behavioral functions. Additionally, the cyclopropyl group can enhance the lipophilicity and metabolic stability of the molecule, making it an interesting candidate for drug development. Its synthesis and characterization involve standard organic chemistry techniques, and it is typically analyzed using methods such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, N-Cyclopropyl-N-(1-methyl-4-piperidinyl)glycine represents a compound of interest in medicinal chemistry and pharmacology.
Formula:C11H20N2O2
InChI:InChI=1S/C11H20N2O2/c1-12-6-4-10(5-7-12)13(8-11(14)15)9-2-3-9/h9-10H,2-8H2,1H3,(H,14,15)
InChI key:InChIKey=RJPIAXYAIBIHLF-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(C1CC1)C2CCN(C)CC2
Synonyms:
  • N-Cyclopropyl-N-(1-methyl-4-piperidinyl)glycine
  • Glycine, N-cyclopropyl-N-(1-methyl-4-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.