CAS 1353961-65-5
:Phenylmethyl N-cyclopropyl-N-[[1-(2-hydroxyethyl)-3-pyrrolidinyl]methyl]carbamate
Description:
Phenylmethyl N-cyclopropyl-N-[[1-(2-hydroxyethyl)-3-pyrrolidinyl]methyl]carbamate, identified by its CAS number 1353961-65-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a carbamate functional group. This compound features a phenylmethyl moiety, a cyclopropyl group, and a pyrrolidine derivative with a hydroxyethyl substituent, contributing to its potential biological activity. The presence of the carbamate group suggests it may exhibit properties typical of such compounds, including potential interactions with enzymes or receptors in biological systems. Its structural components indicate possible applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychological conditions. The compound's solubility, stability, and reactivity would depend on its specific molecular interactions, and its safety profile would need to be evaluated through toxicological studies. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C18H26N2O3
InChI:InChI=1S/C18H26N2O3/c21-11-10-19-9-8-16(12-19)13-20(17-6-7-17)18(22)23-14-15-4-2-1-3-5-15/h1-5,16-17,21H,6-14H2
InChI key:InChIKey=SAYFEELLMPJZDY-UHFFFAOYSA-N
SMILES:N(CC1CN(CCO)CC1)(C(OCC2=CC=CC=C2)=O)C3CC3
Synonyms:- Carbamic acid, N-cyclopropyl-N-[[1-(2-hydroxyethyl)-3-pyrrolidinyl]methyl]-, phenylmethyl ester
- Phenylmethyl N-cyclopropyl-N-[[1-(2-hydroxyethyl)-3-pyrrolidinyl]methyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.