CAS 1353962-22-7
:N-[(2-Bromo-4-pyridinyl)methyl]-N-(1-methylethyl)glycine
Description:
N-[(2-Bromo-4-pyridinyl)methyl]-N-(1-methylethyl)glycine, identified by its CAS number 1353962-22-7, is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring substituted with a bromine atom and a glycine moiety. This compound typically exhibits properties associated with both its pyridine and amino acid components, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amino and carboxyl functional groups. The bromine substitution can influence its reactivity and biological activity, potentially enhancing its interaction with specific biological targets. Additionally, the presence of the isopropyl group contributes to its steric properties, which may affect its pharmacokinetics and dynamics. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing molecules with specific biological activities or therapeutic applications.
Formula:C11H15BrN2O2
InChI:InChI=1S/C11H15BrN2O2/c1-8(2)14(7-11(15)16)6-9-3-4-13-10(12)5-9/h3-5,8H,6-7H2,1-2H3,(H,15,16)
InChI key:InChIKey=YYQLHPPFYDYWDG-UHFFFAOYSA-N
SMILES:C(N(CC(O)=O)C(C)C)C=1C=C(Br)N=CC1
Synonyms:- Glycine, N-[(2-bromo-4-pyridinyl)methyl]-N-(1-methylethyl)-
- N-[(2-Bromo-4-pyridinyl)methyl]-N-(1-methylethyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.