CAS 1353962-57-8
:Phenylmethyl 2-[[(2-aminoethyl)ethylamino]methyl]-1-pyrrolidinecarboxylate
Description:
Phenylmethyl 2-[[(2-aminoethyl)ethylamino]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1353962-57-8, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is characterized by the presence of a carboxylate functional group. The compound also contains an aminoethyl side chain, contributing to its potential biological activity. Its structure suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems or other physiological pathways. The presence of both aromatic and aliphatic components in its structure may confer unique solubility and reactivity properties. While specific applications or uses may vary, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound, given the potential for biological activity and toxicity.
Formula:C17H27N3O2
InChI:InChI=1S/C17H27N3O2/c1-2-19(12-10-18)13-16-9-6-11-20(16)17(21)22-14-15-7-4-3-5-8-15/h3-5,7-8,16H,2,6,9-14,18H2,1H3
InChI key:InChIKey=MLAIDEXCSDRSAA-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C(CN(CCN)CC)CCC2
Synonyms:- 1-Pyrrolidinecarboxylic acid, 2-[[(2-aminoethyl)ethylamino]methyl]-, phenylmethyl ester
- Phenylmethyl 2-[[(2-aminoethyl)ethylamino]methyl]-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.