CAS 1353962-73-8
:2-[[(6-Chloro-3-pyridazinyl)methyl](1-methylethyl)amino]ethanol
Description:
2-[[(6-Chloro-3-pyridazinyl)methyl](1-methylethyl)amino]ethanol, with the CAS number 1353962-73-8, is a chemical compound characterized by its unique structure that includes a pyridazine ring, a chloro substituent, and an ethanol moiety. This compound features a secondary amine due to the presence of the isopropyl group attached to the nitrogen atom, which contributes to its potential biological activity. The chloro group on the pyridazine ring may influence its reactivity and interaction with biological targets. The hydroxyl group in the ethanol part of the molecule can participate in hydrogen bonding, enhancing solubility in polar solvents. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, the structural features of this compound suggest potential applications in drug development and research.
Formula:C10H16ClN3O
InChI:InChI=1S/C10H16ClN3O/c1-8(2)14(5-6-15)7-9-3-4-10(11)13-12-9/h3-4,8,15H,5-7H2,1-2H3
InChI key:InChIKey=NYFAAPMYHZVYSJ-UHFFFAOYSA-N
SMILES:C(N(CCO)C(C)C)C1=CC=C(Cl)N=N1
Synonyms:- Ethanol, 2-[[(6-chloro-3-pyridazinyl)methyl](1-methylethyl)amino]-
- 2-[[(6-Chloro-3-pyridazinyl)methyl](1-methylethyl)amino]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.