CAS 1353962-76-1
:Phenylmethyl N-[[1-(2-aminoacetyl)-2-piperidinyl]methyl]-N-ethylcarbamate
Description:
Phenylmethyl N-[[1-(2-aminoacetyl)-2-piperidinyl]methyl]-N-ethylcarbamate, identified by its CAS number 1353962-76-1, is a synthetic organic compound characterized by its complex structure, which includes a phenylmethyl group, a piperidine ring, and a carbamate functional group. This compound typically exhibits properties associated with both amines and carbamates, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of amino and carbamate functionalities. Its molecular structure suggests it may interact with biological systems, potentially acting as a pharmacological agent. The presence of the piperidine moiety may contribute to its ability to cross biological membranes, while the carbamate group could influence its stability and reactivity. As with many synthetic compounds, its specific characteristics, including melting point, boiling point, and reactivity, would depend on the purity and specific conditions under which it is studied. Further research would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or other fields.
Formula:C18H27N3O3
InChI:InChI=1S/C18H27N3O3/c1-2-20(18(23)24-14-15-8-4-3-5-9-15)13-16-10-6-7-11-21(16)17(22)12-19/h3-5,8-9,16H,2,6-7,10-14,19H2,1H3
InChI key:InChIKey=FDNKMRDHGLKBTP-UHFFFAOYSA-N
SMILES:C(N(C(OCC1=CC=CC=C1)=O)CC)C2N(C(CN)=O)CCCC2
Synonyms:- Phenylmethyl N-[[1-(2-aminoacetyl)-2-piperidinyl]methyl]-N-ethylcarbamate
- Carbamic acid, N-[[1-(2-aminoacetyl)-2-piperidinyl]methyl]-N-ethyl-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.