CAS 1353962-81-8
:1,1-Dimethylethyl 2-[[[(2,3-dihydro-1,4-benzodioxin-2-yl)carbonyl]amino]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 2-[[[(2,3-dihydro-1,4-benzodioxin-2-yl)carbonyl]amino]methyl]-1-pyrrolidinecarboxylate, with CAS number 1353962-81-8, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a benzodioxin moiety. This compound features a dimethyl group that enhances its steric properties, potentially influencing its reactivity and interactions. The presence of a carbonyl group linked to an amino group suggests that it may participate in various chemical reactions, including amide formation and nucleophilic attacks. Its unique structure may confer specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility, stability, and potential for forming hydrogen bonds are important characteristics that can affect its behavior in biological systems and its utility in synthetic applications. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, which is crucial for understanding its potential applications in various fields.
Formula:C19H26N2O5
InChI:InChI=1S/C19H26N2O5/c1-19(2,3)26-18(23)21-10-6-7-13(21)11-20-17(22)16-12-24-14-8-4-5-9-15(14)25-16/h4-5,8-9,13,16H,6-7,10-12H2,1-3H3,(H,20,22)
InChI key:InChIKey=MYVIGGGVAAROKN-UHFFFAOYSA-N
SMILES:C(NC(=O)C1OC=2C(OC1)=CC=CC2)C3N(C(OC(C)(C)C)=O)CCC3
Synonyms:- 1-Pyrrolidinecarboxylic acid, 2-[[[(2,3-dihydro-1,4-benzodioxin-2-yl)carbonyl]amino]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 2-[[[(2,3-dihydro-1,4-benzodioxin-2-yl)carbonyl]amino]methyl]-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.