CAS 1353962-94-3
:2-Amino-N-[2-oxo-2-(2-pyrazinyl)ethyl]acetamide
Description:
2-Amino-N-[2-oxo-2-(2-pyrazinyl)ethyl]acetamide is a chemical compound characterized by its unique structure, which includes an amino group, an acetamide moiety, and a pyrazine ring. This compound features a carbonyl group adjacent to the pyrazine, contributing to its reactivity and potential biological activity. The presence of the amino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrazine ring, which is often associated with bioactive compounds. Additionally, the compound's solubility and stability can be influenced by the functional groups present, making it important for formulation in drug development. Overall, 2-Amino-N-[2-oxo-2-(2-pyrazinyl)ethyl]acetamide represents a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C8H10N4O2
InChI:InChI=1S/C8H10N4O2/c9-3-8(14)12-5-7(13)6-4-10-1-2-11-6/h1-2,4H,3,5,9H2,(H,12,14)
InChI key:InChIKey=HKMNOQWHVIHSIR-UHFFFAOYSA-N
SMILES:C(CNC(CN)=O)(=O)C=1C=NC=CN1
Synonyms:- Acetamide, 2-amino-N-[2-oxo-2-(2-pyrazinyl)ethyl]-
- 2-Amino-N-[2-oxo-2-(2-pyrazinyl)ethyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.