CAS 1353963-01-5
:2-Chloro-1-[4-[cyclopropyl(phenylmethyl)amino]-1-piperidinyl]ethanone
Description:
2-Chloro-1-[4-[cyclopropyl(phenylmethyl)amino]-1-piperidinyl]ethanone is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a piperidine ring, and a cyclopropyl group attached to a phenylmethyl moiety. This compound is typically classified as a ketone due to the presence of the carbonyl functional group (C=O) adjacent to the chloro substituent. Its molecular structure suggests potential pharmacological activity, particularly in the realm of central nervous system modulation, as piperidine derivatives are often explored for their therapeutic effects. The presence of the cyclopropyl group may influence the compound's lipophilicity and receptor binding properties. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its identity and purity. As with many synthetic compounds, safety and handling precautions are essential, given the potential biological activity and toxicity associated with similar chemical structures.
Formula:C17H23ClN2O
InChI:InChI=1S/C17H23ClN2O/c18-12-17(21)19-10-8-16(9-11-19)20(15-6-7-15)13-14-4-2-1-3-5-14/h1-5,15-16H,6-13H2
InChI key:InChIKey=HFRSEGIMKDWSEO-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(C2CC2)C3CCN(C(CCl)=O)CC3
Synonyms:- 2-Chloro-1-[4-[cyclopropyl(phenylmethyl)amino]-1-piperidinyl]ethanone
- Ethanone, 2-chloro-1-[4-[cyclopropyl(phenylmethyl)amino]-1-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.