CAS 1353963-08-2

2-Amino-N-[4-[methyl(phenylmethyl)amino]cyclohexyl]acetamide

Description:

2-Amino-N-[4-[methyl(phenylmethyl)amino]cyclohexyl]acetamide, identified by its CAS number 1353963-08-2, is a chemical compound characterized by its amine and acetamide functional groups. This substance features a cyclohexyl ring, which contributes to its structural complexity and potential steric effects. The presence of both methyl and phenyl groups attached to the nitrogen atom suggests that it may exhibit lipophilic properties, potentially influencing its solubility and interaction with biological membranes. The amino group indicates that it can participate in hydrogen bonding, which may affect its reactivity and interaction with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design and development. However, specific biological activity, toxicity, and pharmacokinetic properties would require further investigation through empirical studies. Overall, the unique combination of functional groups and structural elements makes this compound a candidate for various applications in chemical research and pharmaceutical development.

Formula: C₁₆H₂₅N₃O

InChI: InChI=1S/C16H25N3O/c1-19(12-13-5-3-2-4-6-13)15-9-7-14(8-10-15)18-16(20)11-17/h2-6,14-15H,7-12,17H2,1H3,(H,18,20)

InChI key: InChIKey=NRVJIGPEPQOZII-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)(C)C2CCC(NC(CN)=O)CC2

Synonyms:

• Acetamide, 2-amino-N-[4-[methyl(phenylmethyl)amino]cyclohexyl]-
• 2-Amino-N-[4-[methyl(phenylmethyl)amino]cyclohexyl]acetamide