CAS 1353963-10-6
:N-[(6-Chloro-3-pyridazinyl)methyl]-N-cyclopropylglycine
Description:
N-[(6-Chloro-3-pyridazinyl)methyl]-N-cyclopropylglycine is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with a chlorine atom and a cyclopropyl group attached to a glycine moiety. This compound is notable for its potential biological activity, particularly in the context of pharmacology, where it may act as a modulator of neurotransmitter systems. The presence of the chlorinated pyridazine ring contributes to its lipophilicity and may influence its interaction with biological targets. Additionally, the cyclopropyl group can enhance the compound's metabolic stability and selectivity. The compound's molecular formula and specific stereochemistry can affect its solubility, reactivity, and overall pharmacokinetic properties. As with many compounds in medicinal chemistry, understanding its characteristics is crucial for evaluating its potential therapeutic applications and safety profile. Further studies would be necessary to elucidate its mechanism of action and efficacy in relevant biological systems.
Formula:C10H12ClN3O2
InChI:InChI=1S/C10H12ClN3O2/c11-9-4-1-7(12-13-9)5-14(6-10(15)16)8-2-3-8/h1,4,8H,2-3,5-6H2,(H,15,16)
InChI key:InChIKey=QYJHDOHXBNQICN-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(Cl)N=N1)(CC(O)=O)C2CC2
Synonyms:- Glycine, N-[(6-chloro-3-pyridazinyl)methyl]-N-cyclopropyl-
- N-[(6-Chloro-3-pyridazinyl)methyl]-N-cyclopropylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.