CAS 1353963-20-8
:N-Cyclopropyl-N-[1-(phenylmethyl)-3-pyrrolidinyl]glycine
Description:
N-Cyclopropyl-N-[1-(phenylmethyl)-3-pyrrolidinyl]glycine, identified by its CAS number 1353963-20-8, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a cyclopropyl group and a pyrrolidine ring, which contribute to its unique structural and electronic properties. The presence of the phenylmethyl group enhances its lipophilicity, potentially influencing its pharmacokinetic profile. As a glycine derivative, it may exhibit interactions with neurotransmitter systems, particularly in the central nervous system, making it of interest in medicinal chemistry and drug development. The compound's stereochemistry and functional groups can affect its biological activity, receptor binding, and overall efficacy. While specific data on its solubility, stability, and reactivity may vary, compounds of this nature are often studied for their potential therapeutic applications, including roles in modulating neurotransmission or serving as pharmacological agents. Further research is necessary to fully elucidate its characteristics and potential uses in various scientific fields.
Formula:C16H22N2O2
InChI:InChI=1S/C16H22N2O2/c19-16(20)12-18(14-6-7-14)15-8-9-17(11-15)10-13-4-2-1-3-5-13/h1-5,14-15H,6-12H2,(H,19,20)
InChI key:InChIKey=UAKLPACEACOJDQ-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(C1CN(CC2=CC=CC=C2)CC1)C3CC3
Synonyms:- Glycine, N-cyclopropyl-N-[1-(phenylmethyl)-3-pyrrolidinyl]-
- N-Cyclopropyl-N-[1-(phenylmethyl)-3-pyrrolidinyl]glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.