CAS 1353963-32-2

2-Chloro-N-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]-N-(1-methylethyl)acetamide

Description:

2-Chloro-N-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]-N-(1-methylethyl)acetamide is a synthetic organic compound characterized by its complex structure, which includes a chloro substituent, a benzodioxin moiety, and an acetamide functional group. The presence of the chloro group suggests potential reactivity, while the benzodioxin structure may impart unique chemical properties, such as stability and specific interactions with biological targets. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic components, while the acetamide group may enhance its solubility in polar solvents. Its molecular structure indicates potential applications in medicinal chemistry, possibly as a pharmaceutical agent, given the presence of functional groups that can participate in various chemical reactions. Additionally, the compound's specific stereochemistry and substituents may influence its biological activity and pharmacokinetics. As with many synthetic compounds, safety and handling precautions should be observed, particularly due to the presence of the chlorine atom, which can be associated with toxicity in certain contexts.

Formula: C₁₄H₁₈ClNO₃

InChI: InChI=1S/C14H18ClNO3/c1-10(2)16(14(17)7-15)8-11-9-18-12-5-3-4-6-13(12)19-11/h3-6,10-11H,7-9H2,1-2H3

InChI key: InChIKey=AUHIJRVADWRUKL-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)C(C)C)C1OC=2C(OC1)=CC=CC2

Synonyms:

• Acetamide, 2-chloro-N-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]-N-(1-methylethyl)-
• 2-Chloro-N-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]-N-(1-methylethyl)acetamide