CAS 1353963-43-5

1,1-Dimethylethyl 3-[[(4-methyl-2-pyridinyl)thio]methyl]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-[[(4-methyl-2-pyridinyl)thio]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1353963-43-5, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a thioether functional group. This compound features a dimethyl substituent on the carbon adjacent to the carboxylate group, contributing to its steric properties. The presence of the 4-methyl-2-pyridine moiety suggests potential interactions with biological systems, as pyridine derivatives are often involved in various biochemical processes. The thioether linkage may enhance the compound's lipophilicity, influencing its solubility and permeability in biological membranes. Additionally, the carboxylate group can participate in hydrogen bonding and ionic interactions, which may affect the compound's reactivity and stability. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its biological activity and potential applications.

Formula: C₁₆H₂₄N₂O₂S

InChI: InChI=1S/C16H24N2O2S/c1-12-5-7-17-14(9-12)21-11-13-6-8-18(10-13)15(19)20-16(2,3)4/h5,7,9,13H,6,8,10-11H2,1-4H3

InChI key: InChIKey=TYMLVMCQAMQQKW-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(CSC2=CC(C)=CC=N2)CC1

Synonyms:

• 1,1-Dimethylethyl 3-[[(4-methyl-2-pyridinyl)thio]methyl]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 3-[[(4-methyl-2-pyridinyl)thio]methyl]-, 1,1-dimethylethyl ester