CAS 1353963-53-7

2-[[(2-Iodophenyl)methyl]methylamino]ethanol

Description:

2-[[(2-Iodophenyl)methyl]methylamino]ethanol, identified by its CAS number 1353963-53-7, is a chemical compound characterized by its unique structure that includes an iodine atom attached to a phenyl group, a methylamino group, and an ethanol moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group and the ability to engage in hydrogen bonding. The presence of the iodine atom may impart specific reactivity, influencing its behavior in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with biological targets, potentially leading to pharmacological effects. However, detailed studies would be necessary to fully elucidate its properties, including its stability, reactivity, and potential applications in research or industry. Safety data and handling precautions should also be considered due to the presence of iodine and the amine functional group.

Formula: C₁₀H₁₄INO

InChI: InChI=1S/C10H14INO/c1-12(6-7-13)8-9-4-2-3-5-10(9)11/h2-5,13H,6-8H2,1H3

InChI key: InChIKey=FNWLKTZYSDCCMK-UHFFFAOYSA-N

SMILES: C(N(CCO)C)C1=C(I)C=CC=C1

Synonyms:

• 2-[[(2-Iodophenyl)methyl]methylamino]ethanol
• Ethanol, 2-[[(2-iodophenyl)methyl]methylamino]-