
CAS 1353964-89-2
:1,2-Difluoro-4-[(1S,2R)-2-isocyanatocyclopropyl]benzene
Description:
1,2-Difluoro-4-[(1S,2R)-2-isocyanatocyclopropyl]benzene is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with two fluorine atoms and a cyclopropyl group containing an isocyanate functional group. The presence of the difluoro substituents enhances the compound's reactivity and polarity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The isocyanate group is known for its ability to participate in nucleophilic addition reactions, which can lead to the formation of diverse derivatives. Additionally, the stereochemistry indicated by the (1S,2R) configuration suggests specific spatial arrangements that can influence the compound's biological activity and interaction with other molecules. Overall, this compound's distinctive features, including its fluorinated structure and isocyanate functionality, contribute to its potential utility in synthetic chemistry and material science. Safety considerations should be taken into account due to the reactivity of isocyanates and the potential hazards associated with fluorinated compounds.
Formula:C10H7F2NO
InChI:InChI=1S/C10H7F2NO/c11-8-2-1-6(3-9(8)12)7-4-10(7)13-5-14/h1-3,7,10H,4H2/t7-,10+/m0/s1
InChI key:InChIKey=BPQUHYSXHKRZPP-OIBJUYFYSA-N
SMILES:N(=C=O)[C@H]1[C@@H](C1)C2=CC(F)=C(F)C=C2
Synonyms:- Benzene, 1,2-difluoro-4-[(1S,2R)-2-isocyanatocyclopropyl]-
- 1,2-Difluoro-4-[(1S,2R)-2-isocyanatocyclopropyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
