CAS 1353964-96-1
:2-[Cyclopropyl[1-(phenylmethyl)-4-piperidinyl]amino]ethanol
Description:
2-[Cyclopropyl[1-(phenylmethyl)-4-piperidinyl]amino]ethanol, identified by its CAS number 1353964-96-1, is a chemical compound that features a complex structure incorporating a cyclopropyl group, a piperidine ring, and an ethanol moiety. This compound is characterized by its potential pharmacological properties, particularly in the context of central nervous system activity, due to the presence of the piperidine structure, which is often associated with various therapeutic effects. The cyclopropyl group can influence the compound's lipophilicity and binding affinity to biological targets. Additionally, the presence of the phenylmethyl group may enhance interactions with specific receptors or enzymes. The compound's solubility, stability, and reactivity can be influenced by its functional groups, making it of interest in medicinal chemistry and drug development. Overall, its unique structural features suggest potential applications in pharmacology, although specific biological activities and mechanisms would require further investigation through empirical studies.
Formula:C17H26N2O
InChI:InChI=1S/C17H26N2O/c20-13-12-19(16-6-7-16)17-8-10-18(11-9-17)14-15-4-2-1-3-5-15/h1-5,16-17,20H,6-14H2
InChI key:InChIKey=CHFSULRHEGRYOQ-UHFFFAOYSA-N
SMILES:N(CCO)(C1CC1)C2CCN(CC3=CC=CC=C3)CC2
Synonyms:- Ethanol, 2-[cyclopropyl[1-(phenylmethyl)-4-piperidinyl]amino]-
- 2-[Cyclopropyl[1-(phenylmethyl)-4-piperidinyl]amino]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.