CAS 1353965-23-7
:N-[1-(2-Aminoethyl)-4-piperidinyl]-N-methylacetamide
Description:
N-[1-(2-Aminoethyl)-4-piperidinyl]-N-methylacetamide, identified by its CAS number 1353965-23-7, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with an aminoethyl group and a methylacetamide moiety. This compound typically exhibits properties associated with amines and amides, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in various solvents. The presence of the amino group suggests potential basicity, while the acetamide group may contribute to its stability and reactivity. It is often studied in the context of medicinal chemistry due to its structural features that may interact with biological targets. The compound's specific applications and biological activities would depend on its interaction with various receptors or enzymes, making it of interest in pharmacological research. Safety and handling considerations would also be essential, as with many chemical substances, to ensure proper laboratory practices.
Formula:C10H21N3O
InChI:InChI=1S/C10H21N3O/c1-9(14)12(2)10-3-6-13(7-4-10)8-5-11/h10H,3-8,11H2,1-2H3
InChI key:InChIKey=IKFJJQKMWUDPHT-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C)C1CCN(CCN)CC1
Synonyms:- Acetamide, N-[1-(2-aminoethyl)-4-piperidinyl]-N-methyl-
- N-[1-(2-Aminoethyl)-4-piperidinyl]-N-methylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.