CAS 1353965-38-4
:2-[Cyclopropyl[(1-methyl-3-piperidinyl)methyl]amino]ethanol
Description:
2-[Cyclopropyl[(1-methyl-3-piperidinyl)methyl]amino]ethanol, identified by its CAS number 1353965-38-4, is a chemical compound characterized by its complex structure that includes a cyclopropyl group, a piperidine moiety, and an ethanol backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the hydroxyl (-OH) group. The piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals. The cyclopropyl group may influence the compound's steric properties and reactivity. Additionally, the presence of both an amino group and an alcohol suggests that it could participate in various chemical reactions, including nucleophilic substitutions and esterifications. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development.
Formula:C12H24N2O
InChI:InChI=1S/C12H24N2O/c1-13-6-2-3-11(9-13)10-14(7-8-15)12-4-5-12/h11-12,15H,2-10H2,1H3
InChI key:InChIKey=WCDYQQFVBHDSCG-UHFFFAOYSA-N
SMILES:N(CC1CN(C)CCC1)(CCO)C2CC2
Synonyms:- Ethanol, 2-[cyclopropyl[(1-methyl-3-piperidinyl)methyl]amino]-
- 2-[Cyclopropyl[(1-methyl-3-piperidinyl)methyl]amino]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.