CymitQuimica logo

CAS 1353965-54-4

:

N1-(2-Aminoethyl)-N2,N2-dimethyl-N1-(1-methylethyl)-1,2-cyclohexanediamine

Description:
N1-(2-Aminoethyl)-N2,N2-dimethyl-N1-(1-methylethyl)-1,2-cyclohexanediamine, identified by its CAS number 1353965-54-4, is a chemical compound characterized by its complex structure featuring a cyclohexane ring with multiple amine functional groups. This compound is a derivative of cyclohexanediamine, which contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of aminoethyl and dimethyl groups enhances its reactivity and solubility in polar solvents, making it suitable for use as a ligand in coordination chemistry or as a building block in organic synthesis. Additionally, the branched alkyl group (1-methylethyl) may influence its steric properties and overall molecular stability. As with many amine-containing compounds, it may exhibit basicity and can participate in hydrogen bonding, which can affect its interactions with other molecules. Safety and handling precautions should be observed due to the potential for reactivity and toxicity associated with amines.
Formula:C13H29N3
InChI:InChI=1S/C13H29N3/c1-11(2)16(10-9-14)13-8-6-5-7-12(13)15(3)4/h11-13H,5-10,14H2,1-4H3
InChI key:InChIKey=VCQRHQPOPDTDMB-UHFFFAOYSA-N
SMILES:N(CCN)(C(C)C)C1C(N(C)C)CCCC1
Synonyms:
  • 1,2-Cyclohexanediamine, N1-(2-aminoethyl)-N2,N2-dimethyl-N1-(1-methylethyl)-
  • N1-(2-Aminoethyl)-N2,N2-dimethyl-N1-(1-methylethyl)-1,2-cyclohexanediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.