CAS 1353965-65-7

Phenylmethyl N-[[1-(2-aminoethyl)-3-piperidinyl]methyl]-N-cyclopropylcarbamate

Description:

Phenylmethyl N-[[1-(2-aminoethyl)-3-piperidinyl]methyl]-N-cyclopropylcarbamate, identified by its CAS number 1353965-65-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a carbamate functional group. This compound features a phenylmethyl moiety, a cyclopropyl group, and a piperidine ring, contributing to its potential biological activity. The presence of the aminoethyl side chain suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may impart specific pharmacological properties, potentially influencing its solubility, stability, and reactivity. As with many compounds in this class, it may exhibit properties such as being a potential inhibitor or modulator of certain biological pathways. However, detailed studies would be necessary to elucidate its specific characteristics, including its mechanism of action, toxicity, and therapeutic potential. As of the latest data, further research is likely ongoing to explore its applications in various fields, including pharmaceuticals and biochemistry.

Formula: C₁₉H₂₉N₃O₂

InChI: InChI=1S/C19H29N3O2/c20-10-12-21-11-4-7-17(13-21)14-22(18-8-9-18)19(23)24-15-16-5-2-1-3-6-16/h1-3,5-6,17-18H,4,7-15,20H2

InChI key: InChIKey=AJZVLDXTSUNOPO-UHFFFAOYSA-N

SMILES: N(CC1CN(CCN)CCC1)(C(OCC2=CC=CC=C2)=O)C3CC3

Synonyms:

• Phenylmethyl N-[[1-(2-aminoethyl)-3-piperidinyl]methyl]-N-cyclopropylcarbamate
• Carbamic acid, N-[[1-(2-aminoethyl)-3-piperidinyl]methyl]-N-cyclopropyl-, phenylmethyl ester