CAS 1353965-74-8

1-(2-Aminoethyl)-3-pyrrolidinemethanol

Description:

1-(2-Aminoethyl)-3-pyrrolidinemethanol, identified by its CAS number 1353965-74-8, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an aminoethyl side chain. This compound features both amine and alcohol functional groups, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group suggests that it may engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₇H₁₆N₂O

InChI: InChI=1S/C7H16N2O/c8-2-4-9-3-1-7(5-9)6-10/h7,10H,1-6,8H2

InChI key: InChIKey=MARNVCJPCUFPRX-UHFFFAOYSA-N

SMILES: C(CN)N1CC(CO)CC1

Synonyms:

• 3-Pyrrolidinemethanol, 1-(2-aminoethyl)-
• 1-(2-Aminoethyl)-3-pyrrolidinemethanol
• [1-(2-Aminoethyl)pyrrolidin-3-yl]methanol

[1-(2-Aminoethyl)pyrrolidin-3-yl]methanol

CAS: 1353965-74-8

Versatile small molecule scaffold

Formula: C₇H₁₆N₂O

Purity: Min. 95%

Molecular weight: 144.21 g/mol

Ref: 3D-DEC96574