CAS 1353965-93-1
:2-Amino-N-ethyl-N-(1-methyl-3-piperidinyl)acetamide
Description:
2-Amino-N-ethyl-N-(1-methyl-3-piperidinyl)acetamide is a chemical compound characterized by its amide functional group, which is indicative of its potential as a bioactive molecule. This compound features an amino group, an ethyl substituent, and a piperidine ring, contributing to its structural complexity and potential pharmacological properties. The presence of the piperidine moiety suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems. Its molecular structure allows for hydrogen bonding, which can enhance solubility in polar solvents and may affect its bioavailability. The compound's CAS number, 1353965-93-1, is a unique identifier that facilitates its identification in chemical databases. While specific applications or biological activities may vary, compounds with similar structures are often investigated for their roles in medicinal chemistry, particularly in the development of therapeutic agents. Overall, 2-Amino-N-ethyl-N-(1-methyl-3-piperidinyl)acetamide represents a class of compounds that may hold significance in pharmaceutical research.
Formula:C10H21N3O
InChI:InChI=1S/C10H21N3O/c1-3-13(10(14)7-11)9-5-4-6-12(2)8-9/h9H,3-8,11H2,1-2H3
InChI key:InChIKey=QLILNVYYICHYCV-UHFFFAOYSA-N
SMILES:N(C(CN)=O)(CC)C1CN(C)CCC1
Synonyms:- 2-Amino-N-ethyl-N-(1-methyl-3-piperidinyl)acetamide
- Acetamide, 2-amino-N-ethyl-N-(1-methyl-3-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.