CAS 1353966-02-5
:N-[2-(Dimethylamino)cyclohexyl]-N-(1-methylethyl)glycine
Description:
N-[2-(Dimethylamino)cyclohexyl]-N-(1-methylethyl)glycine, identified by its CAS number 1353966-02-5, is a chemical compound that belongs to the class of amino acids and is characterized by its unique structural features. This substance contains a cyclohexyl group, which contributes to its cyclic structure, and a dimethylamino group that enhances its basicity and potential for interaction with biological systems. The presence of the isopropyl group (1-methylethyl) further influences its steric properties and solubility. As an amino acid derivative, it may exhibit properties such as being a zwitterion at physiological pH, which can affect its solubility and reactivity. The compound's potential applications could span various fields, including pharmaceuticals and biochemistry, particularly in the development of drugs targeting specific receptors or pathways. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its behavior and utility in practical applications.
Formula:C13H26N2O2
InChI:InChI=1S/C13H26N2O2/c1-10(2)15(9-13(16)17)12-8-6-5-7-11(12)14(3)4/h10-12H,5-9H2,1-4H3,(H,16,17)
InChI key:InChIKey=ZANVSWOMLJAJEM-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(C(C)C)C1C(N(C)C)CCCC1
Synonyms:- N-[2-(Dimethylamino)cyclohexyl]-N-(1-methylethyl)glycine
- Glycine, N-[2-(dimethylamino)cyclohexyl]-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.