CymitQuimica logo

CAS 1353966-04-7

:

N-[2-(Cyclopropylamino)cyclohexyl]acetamide

Description:
N-[2-(Cyclopropylamino)cyclohexyl]acetamide, with the CAS number 1353966-04-7, is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a cyclohexyl moiety linked through an acetamide functional group. This compound is typically classified as an amide due to the presence of the carbonyl group (C=O) adjacent to a nitrogen atom. The cyclopropyl and cyclohexyl groups contribute to its three-dimensional structure, potentially influencing its biological activity and interactions with other molecules. The presence of the amino group suggests that it may participate in hydrogen bonding, which can affect its solubility and reactivity. Such compounds are often studied for their pharmacological properties, as modifications in their structure can lead to variations in biological activity. Overall, N-[2-(Cyclopropylamino)cyclohexyl]acetamide represents a class of compounds that may have applications in medicinal chemistry and drug development, although specific biological activities would require further investigation.
Formula:C11H20N2O
InChI:InChI=1S/C11H20N2O/c1-8(14)12-10-4-2-3-5-11(10)13-9-6-7-9/h9-11,13H,2-7H2,1H3,(H,12,14)
InChI key:InChIKey=IMTMDFCUWKPHME-UHFFFAOYSA-N
SMILES:N(C1C(NC(C)=O)CCCC1)C2CC2
Synonyms:
  • Acetamide, N-[2-(cyclopropylamino)cyclohexyl]-
  • N-[2-(Cyclopropylamino)cyclohexyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.