CymitQuimica logo

CAS 1353966-10-5

:

N-[[1-(2-Aminoacetyl)-3-pyrrolidinyl]methyl]-N-(1-methylethyl)acetamide

Description:
N-[[1-(2-Aminoacetyl)-3-pyrrolidinyl]methyl]-N-(1-methylethyl)acetamide, identified by its CAS number 1353966-10-5, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an acetamide functional group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to the presence of amino and pyrrolidine moieties. The presence of the aminoacetyl group suggests that it may participate in various biochemical interactions, possibly influencing its pharmacological profile. Its molecular structure indicates that it could be involved in hydrogen bonding, which may affect its reactivity and interaction with biological targets. Additionally, the presence of the isopropyl group (1-methylethyl) may contribute to its lipophilicity, influencing its absorption and distribution in biological systems. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C12H23N3O2
InChI:InChI=1S/C12H23N3O2/c1-9(2)15(10(3)16)8-11-4-5-14(7-11)12(17)6-13/h9,11H,4-8,13H2,1-3H3
InChI key:InChIKey=HGHSCFSETIZDNC-UHFFFAOYSA-N
SMILES:C(N(C(C)C)C(C)=O)C1CN(C(CN)=O)CC1
Synonyms:
  • N-[[1-(2-Aminoacetyl)-3-pyrrolidinyl]methyl]-N-(1-methylethyl)acetamide
  • Acetamide, N-[[1-(2-aminoacetyl)-3-pyrrolidinyl]methyl]-N-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.