CAS 1353966-25-2
:2-Amino-N-cyclopropyl-N-[1-(phenylmethyl)-3-piperidinyl]acetamide
Description:
2-Amino-N-cyclopropyl-N-[1-(phenylmethyl)-3-piperidinyl]acetamide is a chemical compound characterized by its complex structure, which includes an acetamide functional group, a cyclopropyl group, and a piperidine ring substituted with a phenylmethyl group. This compound is notable for its potential pharmacological properties, particularly in the context of neuropharmacology, where it may interact with various neurotransmitter systems. The presence of the amino group suggests it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The cyclopropyl moiety contributes to its rigidity and may influence its biological activity by affecting receptor binding. Additionally, the piperidine ring is often associated with compounds that exhibit central nervous system activity. Overall, this compound's unique structural features may confer specific biological activities, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C17H25N3O
InChI:InChI=1S/C17H25N3O/c18-11-17(21)20(15-8-9-15)16-7-4-10-19(13-16)12-14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13,18H2
InChI key:InChIKey=NPGBTYVYFSQFSI-UHFFFAOYSA-N
SMILES:N(C(CN)=O)(C1CN(CC2=CC=CC=C2)CCC1)C3CC3
Synonyms:- 2-Amino-N-cyclopropyl-N-[1-(phenylmethyl)-3-piperidinyl]acetamide
- Acetamide, 2-amino-N-cyclopropyl-N-[1-(phenylmethyl)-3-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.