CAS 1353966-38-7
:2-Chloro-N-[2-(cyclopropylmethylamino)cyclohexyl]acetamide
Description:
2-Chloro-N-[2-(cyclopropylmethylamino)cyclohexyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and an acetamide functional group. This compound features a cyclohexyl ring and a cyclopropylmethylamino moiety, contributing to its potential biological activity. The presence of the chlorine atom may influence its reactivity and interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, particularly in the context of drug development, where modifications to the amine and acetamide groups can affect solubility, potency, and selectivity. The molecular structure suggests potential applications in medicinal chemistry, possibly as a therapeutic agent. Additionally, the compound's stability, solubility, and interaction with various biological systems would be of interest in both research and practical applications. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.
Formula:C12H21ClN2O
InChI:InChI=1S/C12H21ClN2O/c1-15(9-6-7-9)11-5-3-2-4-10(11)14-12(16)8-13/h9-11H,2-8H2,1H3,(H,14,16)
InChI key:InChIKey=AMOBYPIAMRDTSV-UHFFFAOYSA-N
SMILES:N(C)(C1C(NC(CCl)=O)CCCC1)C2CC2
Synonyms:- 2-Chloro-N-[2-(cyclopropylmethylamino)cyclohexyl]acetamide
- Acetamide, 2-chloro-N-[2-(cyclopropylmethylamino)cyclohexyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.