CAS 1353966-57-0
:1,1-Dimethylethyl 3-[[(2-aminoacetyl)cyclopropylamino]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 3-[[(2-aminoacetyl)cyclopropylamino]methyl]-1-pyrrolidinecarboxylate, with the CAS number 1353966-57-0, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a cyclopropyl group. This compound features a dimethyl substituent, contributing to its steric bulk, and an aminoacetyl moiety that suggests potential biological activity, possibly related to interactions with amino acids or peptides. The presence of the carboxylate functional group indicates that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. Additionally, the cyclopropyl group can impart unique steric and electronic effects, potentially affecting the compound's pharmacological profile. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of novel therapeutic agents, due to its intricate structure and the potential for diverse interactions within biological systems. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C15H27N3O3
InChI:InChI=1S/C15H27N3O3/c1-15(2,3)21-14(20)17-7-6-11(9-17)10-18(12-4-5-12)13(19)8-16/h11-12H,4-10,16H2,1-3H3
InChI key:InChIKey=RVRLDHCVUBDXCH-UHFFFAOYSA-N
SMILES:N(CC1CN(C(OC(C)(C)C)=O)CC1)(C(CN)=O)C2CC2
Synonyms:- 1,1-Dimethylethyl 3-[[(2-aminoacetyl)cyclopropylamino]methyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 3-[[(2-aminoacetyl)cyclopropylamino]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.