CAS 1353966-63-8
:1-[4-[[(2-Hydroxyethyl)amino]methyl]-1-piperidinyl]ethanone
Description:
1-[4-[[(2-Hydroxyethyl)amino]methyl]-1-piperidinyl]ethanone, identified by its CAS number 1353966-63-8, is a chemical compound characterized by its complex structure that includes a piperidine ring and a hydroxyethylamino group. This compound typically exhibits properties associated with amines and ketones, such as potential solubility in polar solvents due to the presence of hydroxyl and amino functional groups. It may participate in hydrogen bonding, influencing its reactivity and interactions with biological systems. The piperidine moiety contributes to its cyclic structure, which can affect its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of the ethanone group suggests potential reactivity in condensation or substitution reactions. Overall, this compound's unique structural features may confer specific biological activities, making it a candidate for further research in drug development or other applications in the pharmaceutical industry.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-9(14)12-5-2-10(3-6-12)8-11-4-7-13/h10-11,13H,2-8H2,1H3
InChI key:InChIKey=HMTAHNIRFIKKRC-UHFFFAOYSA-N
SMILES:C(NCCO)C1CCN(C(C)=O)CC1
Synonyms:- 1-[4-[[(2-Hydroxyethyl)amino]methyl]-1-piperidinyl]ethanone
- Ethanone, 1-[4-[[(2-hydroxyethyl)amino]methyl]-1-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.