CAS 1353966-64-9

1,1-Dimethylethyl N-[[1-(2-aminoacetyl)-2-piperidinyl]methyl]-N-cyclopropylcarbamate

Description:

1,1-Dimethylethyl N-[[1-(2-aminoacetyl)-2-piperidinyl]methyl]-N-cyclopropylcarbamate, identified by its CAS number 1353966-64-9, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a piperidine ring, and a cyclopropyl group, which contribute to its unique properties. The compound is likely to exhibit moderate to high lipophilicity due to the presence of hydrophobic groups, which may influence its solubility in organic solvents. Additionally, the aminoacetyl moiety suggests potential biological activity, possibly interacting with specific receptors or enzymes. The presence of the carbamate functional group indicates that it may undergo hydrolysis under certain conditions, leading to the release of the corresponding amine and carbon dioxide. Overall, this compound's structural features suggest it may have applications in medicinal chemistry or as a potential pharmacological agent, although specific biological activities and safety profiles would require further investigation.

Formula: C₁₆H₂₉N₃O₃

InChI: InChI=1S/C16H29N3O3/c1-16(2,3)22-15(21)19(12-7-8-12)11-13-6-4-5-9-18(13)14(20)10-17/h12-13H,4-11,17H2,1-3H3

InChI key: InChIKey=PTSPDCKVUZEZOX-UHFFFAOYSA-N

SMILES: N(CC1N(C(CN)=O)CCCC1)(C(OC(C)(C)C)=O)C2CC2

Synonyms:

• 1,1-Dimethylethyl N-[[1-(2-aminoacetyl)-2-piperidinyl]methyl]-N-cyclopropylcarbamate
• Carbamic acid, N-[[1-(2-aminoacetyl)-2-piperidinyl]methyl]-N-cyclopropyl-, 1,1-dimethylethyl ester