CAS 1353966-74-1
:3-[[[(1,1-Dimethylethoxy)carbonyl]methylamino]methyl]-1-pyrrolidineacetic acid
Description:
3-[[[(1,1-Dimethylethoxy)carbonyl]methylamino]methyl]-1-pyrrolidineacetic acid is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an acetic acid moiety. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a bulky protective group, which can influence its reactivity and solubility. This compound is likely to exhibit properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions, including peptide bond formation. Its structure suggests potential applications in medicinal chemistry, particularly in the design of pharmaceuticals that target specific biological pathways. The compound's solubility, stability, and reactivity would be influenced by the functional groups present, making it a candidate for further study in drug development or as a biochemical tool. As with many compounds of this nature, safety and handling precautions should be observed due to potential biological activity or toxicity.
Formula:C13H24N2O4
InChI:InChI=1S/C13H24N2O4/c1-13(2,3)19-12(18)14(4)7-10-5-6-15(8-10)9-11(16)17/h10H,5-9H2,1-4H3,(H,16,17)
InChI key:InChIKey=UEGZUDINZCLSIP-UHFFFAOYSA-N
SMILES:C(N(C(OC(C)(C)C)=O)C)C1CN(CC(O)=O)CC1
Synonyms:- 3-[[[(1,1-Dimethylethoxy)carbonyl]methylamino]methyl]-1-pyrrolidineacetic acid
- 1-Pyrrolidineacetic acid, 3-[[[(1,1-dimethylethoxy)carbonyl]methylamino]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.