CymitQuimica logo

CAS 1353966-86-5

:

3-[[[(Phenylmethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid

Description:
3-[[[(Phenylmethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring, an acetic acid moiety, and a phenylmethoxycarbonyl group. This compound is typically classified as an amino acid derivative due to the presence of both an amino group and a carboxylic acid group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity related to its functional groups. The presence of the piperidine ring can contribute to its pharmacological properties, influencing solubility, binding affinity, and overall bioactivity. Additionally, the phenylmethoxy group may enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. As with many compounds of this nature, careful consideration of its synthesis, stability, and reactivity is essential for practical applications in research and development.
Formula:C16H22N2O4
InChI:InChI=1S/C16H22N2O4/c19-15(20)11-18-8-4-7-14(10-18)9-17-16(21)22-12-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2,(H,17,21)(H,19,20)
InChI key:InChIKey=GMCJAJRDQGANJE-UHFFFAOYSA-N
SMILES:C(NC(OCC1=CC=CC=C1)=O)C2CN(CC(O)=O)CCC2
Synonyms:
  • 1-Piperidineacetic acid, 3-[[[(phenylmethoxy)carbonyl]amino]methyl]-
  • 3-[[[(Phenylmethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.