CymitQuimica logo

CAS 1353966-93-4

:

2-Amino-N-cyclopropyl-N-(2-pyrazinylmethyl)acetamide

Description:
2-Amino-N-cyclopropyl-N-(2-pyrazinylmethyl)acetamide is a chemical compound characterized by its unique structure, which includes an acetamide functional group, a cyclopropyl moiety, and a pyrazine ring. This compound features an amino group that contributes to its potential as a biological agent, possibly influencing its interaction with various biological targets. The presence of the cyclopropyl group may impart distinctive steric and electronic properties, while the pyrazinylmethyl substituent can enhance its lipophilicity and facilitate interactions with biological membranes. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature. Additionally, the compound's safety profile and toxicity would need to be evaluated through appropriate studies to determine its suitability for therapeutic use. Overall, 2-Amino-N-cyclopropyl-N-(2-pyrazinylmethyl)acetamide represents a compound of interest in the field of drug discovery and development.
Formula:C10H14N4O
InChI:InChI=1S/C10H14N4O/c11-5-10(15)14(9-1-2-9)7-8-6-12-3-4-13-8/h3-4,6,9H,1-2,5,7,11H2
InChI key:InChIKey=BKEMEWJMUHJCOD-UHFFFAOYSA-N
SMILES:N(CC=1C=NC=CN1)(C(CN)=O)C2CC2
Synonyms:
  • 2-Amino-N-cyclopropyl-N-(2-pyrazinylmethyl)acetamide
  • Acetamide, 2-amino-N-cyclopropyl-N-(2-pyrazinylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.