CAS 1353969-92-2

N-[4-[(2-Chloroacetyl)amino]cyclohexyl]-N-cyclopropylacetamide

Description:

N-[4-[(2-Chloroacetyl)amino]cyclohexyl]-N-cyclopropylacetamide, identified by its CAS number 1353969-92-2, is a synthetic organic compound characterized by its complex molecular structure. This substance features a cyclohexyl group and a cyclopropyl group, which contribute to its unique steric and electronic properties. The presence of a chloroacetyl moiety indicates potential reactivity, particularly in nucleophilic substitution reactions. The amide functional group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with biological systems. This compound may be of interest in medicinal chemistry, potentially serving as a lead compound for drug development due to its structural features that could interact with biological targets. Its stability, reactivity, and biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species. As with many synthetic compounds, safety and handling precautions should be observed, given the presence of chlorine, which can pose health risks.

Formula: C₁₃H₂₁ClN₂O₂

InChI: InChI=1S/C13H21ClN2O2/c1-9(17)16(12-6-7-12)11-4-2-10(3-5-11)15-13(18)8-14/h10-12H,2-8H2,1H3,(H,15,18)

InChI key: InChIKey=MBFYYBMYFARLQG-UHFFFAOYSA-N

SMILES: N(C(C)=O)(C1CCC(NC(CCl)=O)CC1)C2CC2

Synonyms:

• Acetamide, N-[4-[(2-chloroacetyl)amino]cyclohexyl]-N-cyclopropyl-
• N-[4-[(2-Chloroacetyl)amino]cyclohexyl]-N-cyclopropylacetamide