CAS 135397-30-7
:Halosulfuron
Description:
Halosulfuron is a selective herbicide primarily used for controlling certain broadleaf weeds and sedges in various crops, particularly in rice and turf management. It belongs to the sulfonylurea class of herbicides, which function by inhibiting the enzyme acetolactate synthase (ALS), crucial for the synthesis of essential amino acids in plants. This inhibition leads to the cessation of growth and eventual death of the targeted weeds. Halosulfuron is characterized by its systemic action, allowing it to be absorbed by the foliage and roots, providing effective control even in challenging conditions. It is typically applied post-emergence and is known for its low toxicity to mammals, making it relatively safe for use in agricultural settings. Additionally, Halosulfuron has a moderate persistence in the environment, necessitating careful management to prevent potential impacts on non-target species and ecosystems. Its effectiveness and selectivity make it a valuable tool in integrated weed management strategies.
Formula:C12H13ClN6O7S
InChI:InChI=1S/C12H13ClN6O7S/c1-19-9(7(10(20)21)8(13)17-19)27(23,24)18-12(22)16-11-14-5(25-2)4-6(15-11)26-3/h4H,1-3H3,(H,20,21)(H2,14,15,16,18,22)
InChI key:InChIKey=LXKOADMMGWXPJQ-UHFFFAOYSA-N
SMILES:S(NC(NC=1N=C(OC)C=C(OC)N1)=O)(=O)(=O)C2=C(C(O)=O)C(Cl)=NN2C
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 3-chloro-5-(((((4,6-dimethoxy-2-pyrimidinyl)amino)carbonyl)amino)sulfonyl)-1-methyl-
- 3-Chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylic acid
- 3-Chloro-5-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-1-methyl-1H-pyrazole-4-carboxylic acid
- 3-chloro-5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylic acid
- Halosulfuron
- Halosulfuron [ISO:BSI]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Halosulfuron
CAS:Halosulfuron is a medicinal analog that has been shown to inhibit the growth of tumor and cancer cells by inducing apoptosis. It works by inhibiting kinases, which are enzymes that regulate various cellular processes including cell division and proliferation. Halosulfuron has been found in urine samples of patients with anticancer activity, indicating its potential as an inhibitor of human cancer. This compound also shows potent activity against Chinese hamster ovary cells and other cell lines, making it a promising candidate for the development of new cancer therapies. Additionally, Halosulfuron is known to be a potent protein kinase inhibitor that can be used in the treatment of various types of cancers.
Formula:C12H13ClN6O7SPurity:Min. 95%Molecular weight:420.79 g/mol

