CAS 1353971-11-5
:1,1-Dimethylethyl N-[2-[(1-methylethyl)amino]cyclohexyl]carbamate
Description:
1,1-Dimethylethyl N-[2-[(1-methylethyl)amino]cyclohexyl]carbamate, identified by its CAS number 1353971-11-5, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics such as being a white to off-white solid or crystalline powder, which is soluble in organic solvents but may have limited solubility in water. Its molecular structure features a carbamate functional group, which is known for its potential biological activity, particularly in agricultural applications as a pesticide or herbicide. The presence of the cyclohexyl and isopropyl groups in its structure suggests that it may interact with biological systems, potentially affecting enzyme activity or receptor binding. Additionally, the compound may exhibit moderate stability under standard conditions, although it is essential to consider its reactivity with acids or bases. Safety data should be reviewed to assess any potential hazards, including toxicity and environmental impact, as is standard for chemical substances used in various applications.
Formula:C14H28N2O2
InChI:InChI=1S/C14H28N2O2/c1-10(2)15-11-8-6-7-9-12(11)16-13(17)18-14(3,4)5/h10-12,15H,6-9H2,1-5H3,(H,16,17)
InChI key:InChIKey=NLOZWKJOKIDHPP-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1C(NC(C)C)CCCC1
Synonyms:- 1,1-Dimethylethyl N-[2-[(1-methylethyl)amino]cyclohexyl]carbamate
- Carbamic acid, N-[2-[(1-methylethyl)amino]cyclohexyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.