CAS 1353971-44-4

Phenylmethyl 2-[(methylamino)methyl]-1-piperidinecarboxylate

Description:

Phenylmethyl 2-[(methylamino)methyl]-1-piperidinecarboxylate, identified by its CAS number 1353971-44-4, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with a phenylmethyl group and a methylamino group. This structure suggests potential pharmacological activity, as piperidine derivatives are often explored for their biological properties, including analgesic and psychoactive effects. The presence of the carboxylate functional group indicates that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. Additionally, the methylamino substitution can enhance its lipophilicity, potentially affecting its ability to cross biological membranes. Overall, the compound's unique structure may contribute to its interaction with biological targets, making it of interest in medicinal chemistry and drug development. However, specific biological activity and safety profiles would require further investigation through experimental studies.

Formula: C₁₅H₂₂N₂O₂

InChI: InChI=1S/C15H22N2O2/c1-16-11-14-9-5-6-10-17(14)15(18)19-12-13-7-3-2-4-8-13/h2-4,7-8,14,16H,5-6,9-12H2,1H3

InChI key: InChIKey=UWMPGXUYXQOFBY-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2C(CNC)CCCC2

Synonyms:

• Phenylmethyl 2-[(methylamino)methyl]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 2-[(methylamino)methyl]-, phenylmethyl ester
• 2-Methylaminomethyl-piperidine-1-carboxylic acid benzyl ester