CAS 1353971-47-7
:2-Amino-N-[1-(phenylmethyl)-3-piperidinyl]acetamide
Description:
2-Amino-N-[1-(phenylmethyl)-3-piperidinyl]acetamide, identified by its CAS number 1353971-47-7, is a chemical compound characterized by its amine and acetamide functional groups. This substance features a piperidine ring, which contributes to its cyclic structure and potential biological activity. The presence of the phenylmethyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The amino group indicates that it can participate in hydrogen bonding, which may affect its solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structural features suggest potential applications in areas such as neuropharmacology or as a building block for more complex molecules. However, specific data regarding its toxicity, stability, and detailed biological activity would require further investigation and empirical studies.
Formula:C14H21N3O
InChI:InChI=1S/C14H21N3O/c15-9-14(18)16-13-7-4-8-17(11-13)10-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11,15H2,(H,16,18)
InChI key:InChIKey=TWDBPFSITKTFCX-UHFFFAOYSA-N
SMILES:C(N1CC(NC(CN)=O)CCC1)C2=CC=CC=C2
Synonyms:- Acetamide, 2-amino-N-[1-(phenylmethyl)-3-piperidinyl]-
- 2-Amino-N-[1-(phenylmethyl)-3-piperidinyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.