CAS 1353971-48-8
:2-[[4-[[(Phenylmethoxy)carbonyl]amino]cyclohexyl]oxy]acetic acid
Description:
2-[[4-[[(Phenylmethoxy)carbonyl]amino]cyclohexyl]oxy]acetic acid, with the CAS number 1353971-48-8, is a chemical compound characterized by its complex structure, which includes a cyclohexyl group, a phenylmethoxy moiety, and an acetic acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, suggesting potential for hydrogen bonding and solubility in polar solvents. The presence of the phenyl group may contribute to its hydrophobic characteristics, while the acetic acid component can impart acidic properties. The compound's structure indicates potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or active ingredient, due to its ability to interact with biological systems. Its specific reactivity and stability would depend on the surrounding conditions, such as pH and temperature. Overall, this compound represents a unique combination of functional groups that may offer diverse chemical behavior and potential therapeutic applications.
Formula:C16H21NO5
InChI:InChI=1S/C16H21NO5/c18-15(19)11-21-14-8-6-13(7-9-14)17-16(20)22-10-12-4-2-1-3-5-12/h1-5,13-14H,6-11H2,(H,17,20)(H,18,19)
InChI key:InChIKey=WEHUZERBBLYWQB-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)C2CCC(OCC(O)=O)CC2
Synonyms:- 2-[[4-[[(Phenylmethoxy)carbonyl]amino]cyclohexyl]oxy]acetic acid
- Acetic acid, 2-[[4-[[(phenylmethoxy)carbonyl]amino]cyclohexyl]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.