CAS 1353971-58-0

Phenylmethyl N-methyl-N-[4-(methylamino)cyclohexyl]carbamate

Description:

Phenylmethyl N-methyl-N-[4-(methylamino)cyclohexyl]carbamate, identified by its CAS number 1353971-58-0, is a chemical compound that belongs to the class of carbamates. This substance features a phenylmethyl group, which contributes to its aromatic characteristics, and a cyclohexyl moiety that introduces a cyclic structure into its framework. The presence of a methylamino group indicates that it has potential basic properties, which may influence its reactivity and interaction with biological systems. Carbamates are known for their applications in various fields, including pharmaceuticals and agrochemicals, often acting as inhibitors or modulators of enzymatic activity. The specific structural features of this compound suggest it may exhibit unique pharmacological properties, potentially affecting neurotransmitter systems or other biological pathways. Its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature, making it essential to consider these factors in practical applications or research contexts.

Formula: C₁₆H₂₄N₂O₂

InChI: InChI=1S/C16H24N2O2/c1-17-14-8-10-15(11-9-14)18(2)16(19)20-12-13-6-4-3-5-7-13/h3-7,14-15,17H,8-12H2,1-2H3

InChI key: InChIKey=FSUUAUQGTHSDRB-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)(C)C2CCC(NC)CC2

Synonyms:

• Carbamic acid, N-methyl-N-[4-(methylamino)cyclohexyl]-, phenylmethyl ester
• Phenylmethyl N-methyl-N-[4-(methylamino)cyclohexyl]carbamate