CymitQuimica logo

CAS 1353972-18-5

:

6-Bromo-N-cyclopropyl-3-pyridazinamine

Description:
6-Bromo-N-cyclopropyl-3-pyridazinamine is a chemical compound characterized by its unique structure, which includes a pyridazine ring, a bromine atom, and a cyclopropyl group. The presence of the bromine substituent at the 6-position of the pyridazine ring contributes to its reactivity and potential applications in medicinal chemistry. The cyclopropyl group, known for its strain and unique reactivity, can influence the compound's biological activity and pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in drug discovery and development. Its molecular structure suggests potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's properties, such as solubility, stability, and reactivity, are influenced by the functional groups present. Overall, 6-Bromo-N-cyclopropyl-3-pyridazinamine represents a class of compounds that may have significant implications in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C7H8BrN3
InChI:InChI=1S/C7H8BrN3/c8-6-3-4-7(11-10-6)9-5-1-2-5/h3-5H,1-2H2,(H,9,11)
InChI key:InChIKey=NYHBLFJJEGMXRQ-UHFFFAOYSA-N
SMILES:N(C1CC1)C2=CC=C(Br)N=N2
Synonyms:
  • 6-Bromo-N-cyclopropyl-3-pyridazinamine
  • (6-Bromo-pyridazin-3-yl)-cyclopropyl-amine
  • 3-Pyridazinamine, 6-bromo-N-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.