CymitQuimica logo

CAS 1353972-35-6

:

N1-Ethyl-N1-[(1-methyl-2-piperidinyl)methyl]-1,2-ethanediamine

Description:
N1-Ethyl-N1-[(1-methyl-2-piperidinyl)methyl]-1,2-ethanediamine, identified by its CAS number 1353972-35-6, is a chemical compound characterized by its amine functional groups and a piperidine ring structure. This substance features two primary amine groups, which contribute to its potential as a ligand in coordination chemistry and its reactivity in various organic synthesis processes. The presence of the ethyl and piperidinyl substituents enhances its lipophilicity, potentially influencing its biological activity and pharmacokinetic properties. The compound may exhibit properties typical of tertiary amines, such as basicity and nucleophilicity, making it relevant in medicinal chemistry and drug design. Its structural complexity suggests potential applications in the development of pharmaceuticals, particularly in areas targeting the central nervous system, given the piperidine moiety's common occurrence in psychoactive compounds. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant regulatory sources before use.
Formula:C11H25N3
InChI:InChI=1S/C11H25N3/c1-3-14(9-7-12)10-11-6-4-5-8-13(11)2/h11H,3-10,12H2,1-2H3
InChI key:InChIKey=IZPRKLGMTMRPDT-UHFFFAOYSA-N
SMILES:C(N(CCN)CC)C1N(C)CCCC1
Synonyms:
  • N1-Ethyl-N1-[(1-methyl-2-piperidinyl)methyl]-1,2-ethanediamine
  • 1,2-Ethanediamine, N1-ethyl-N1-[(1-methyl-2-piperidinyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.