CymitQuimica logo

CAS 1353972-52-7

:

3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidineacetic acid

Description:
3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidineacetic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and an amino acid moiety. The presence of the 1,1-dimethylethoxycarbonyl group contributes to its stability and solubility in organic solvents. This compound typically exhibits properties associated with amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions, including peptide bond formation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. The compound may also exhibit specific stereochemical configurations, influencing its biological activity and interactions. Additionally, the presence of functional groups such as carboxylic acids and amines can affect its reactivity and solubility in different environments. Overall, this compound represents a versatile structure with potential implications in drug design and synthesis.
Formula:C12H22N2O4
InChI:InChI=1S/C12H22N2O4/c1-12(2,3)18-11(17)13-9-5-4-6-14(7-9)8-10(15)16/h9H,4-8H2,1-3H3,(H,13,17)(H,15,16)
InChI key:InChIKey=XLJZVODYVORIOT-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1CN(CC(O)=O)CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.